C24H23N3O2 — CID 142923789
N-[1-amino-2-(hydroxyamino)ethyl]-4-[2-(4-benzylphenyl)ethynyl]benzamide (PubChem CID 142923789) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[1-amino-2-(hydroxyamino)ethyl]-4-[2-(4-benzylphenyl)ethynyl]benzamide.
| Compound Name | N-[1-amino-2-(hydroxyamino)ethyl]-4-[2-(4-benzylphenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 142923789 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[1-amino-2-(hydroxyamino)ethyl]-4-[2-(4-benzylphenyl)ethynyl]benzamide |
| SMILES | NC(CNO)NC(=O)c1ccc(C#Cc2ccc(Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O2/c25-23(17-26-29)27-24(28)22-14-12-19(13-15-22)7-6-18-8-10-21(11-9-18)16-20-4-2-1-3-5-20/h1-5,8-15,23,26,29H,16-17,25H2,(H,27,28) |
| InChIKey | PAWDJVFGHIMPFS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|