C22H29NO — CID 21361632
N-(3,3-dimethylbutyl)-4-(4-propylphenyl)benzamide (PubChem CID 21361632) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-4-(4-propylphenyl)benzamide.
| Compound Name | N-(3,3-dimethylbutyl)-4-(4-propylphenyl)benzamide |
|---|---|
| PubChem CID | 21361632 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | N-(3,3-dimethylbutyl)-4-(4-propylphenyl)benzamide |
| SMILES | CCCc1ccc(-c2ccc(C(=O)NCCC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29NO/c1-5-6-17-7-9-18(10-8-17)19-11-13-20(14-12-19)21(24)23-16-15-22(2,3)4/h7-14H,5-6,15-16H2,1-4H3,(H,23,24) |
| InChIKey | AGRFBHWEJBGIDA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |