C19H22N2O4 — CID 159795250
N-[(3S)-1-hydroxy-4-methyl-4-(methylamino)-2-oxopentan-3-yl]-4-(5-hydroxypenta-1,3-diynyl)benzamide (PubChem CID 159795250) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(3S)-1-hydroxy-4-methyl-4-(methylamino)-2-oxopentan-3-yl]-4-(5-hydroxypenta-1,3-diynyl)benzamide.
| Compound Name | N-[(3S)-1-hydroxy-4-methyl-4-(methylamino)-2-oxopentan-3-yl]-4-(5-hydroxypenta-1,3-diynyl)benzamide |
|---|---|
| PubChem CID | 159795250 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(3S)-1-hydroxy-4-methyl-4-(methylamino)-2-oxopentan-3-yl]-4-(5-hydroxypenta-1,3-diynyl)benzamide |
| SMILES | CNC(C)(C)[C@H](NC(=O)c1ccc(C#CC#CCO)cc1)C(=O)CO |
| InChI | InChI=1S/C19H22N2O4/c1-19(2,20-3)17(16(24)13-23)21-18(25)15-10-8-14(9-11-15)7-5-4-6-12-22/h8-11,17,20,22-23H,12-13H2,1-3H3,(H,21,25)/t17-/m1/s1 |
| InChIKey | INOHRXODVIASRT-QGZVFWFLSA-N |
| XLogP | -0.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|