C24H26ClNO5 — CID 102006238
2-[2-(2-chloroethoxy)ethoxy]ethyl 2-[(4-ethynylbenzoyl)amino]-3-phenylpropanoate (PubChem CID 102006238) has the molecular formula C24H26ClNO5 and a molecular weight of 443.93 g/mol. Its IUPAC name is 2-[2-(2-chloroethoxy)ethoxy]ethyl 2-[(4-ethynylbenzoyl)amino]-3-phenylpropanoate.
| Compound Name | 2-[2-(2-chloroethoxy)ethoxy]ethyl 2-[(4-ethynylbenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102006238 |
| Molecular Formula | C24H26ClNO5 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[2-(2-chloroethoxy)ethoxy]ethyl 2-[(4-ethynylbenzoyl)amino]-3-phenylpropanoate |
| SMILES | C#Cc1ccc(C(=O)NC(Cc2ccccc2)C(=O)OCCOCCOCCCl)cc1 |
| InChI | InChI=1S/C24H26ClNO5/c1-2-19-8-10-21(11-9-19)23(27)26-22(18-20-6-4-3-5-7-20)24(28)31-17-16-30-15-14-29-13-12-25/h1,3-11,22H,12-18H2,(H,26,27) |
| InChIKey | XZRQFZSCGZIKLU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|