C24H24NO4- — CID 7319741
(2R)-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoate (PubChem CID 7319741) has the molecular formula C24H24NO4- and a molecular weight of 390.46 g/mol. Its IUPAC name is (2R)-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoate.
| Compound Name | (2R)-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7319741 |
| Molecular Formula | C24H24NO4- |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2R)-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoate |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)[O-])c1ccc(C#CC2(O)CCCCC2)cc1 |
| InChI | InChI=1S/C24H25NO4/c26-22(25-21(23(27)28)17-19-7-3-1-4-8-19)20-11-9-18(10-12-20)13-16-24(29)14-5-2-6-15-24/h1,3-4,7-12,21,29H,2,5-6,14-15,17H2,(H,25,26)(H,27,28)/p-1/t21-/m1/s1 |
| InChIKey | ZONHHYQGKZBPHC-OAQYLSRUSA-M |
| XLogP | 1.82 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|