C24H25NO4 — CID 1251240
(3S)-3-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 1251240) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (3S)-3-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 1251240 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (3S)-3-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccc(C#CC2(O)CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO4/c26-22(27)17-21(19-7-3-1-4-8-19)25-23(28)20-11-9-18(10-12-20)13-16-24(29)14-5-2-6-15-24/h1,3-4,7-12,21,29H,2,5-6,14-15,17H2,(H,25,28)(H,26,27)/t21-/m0/s1 |
| InChIKey | NJSHHPSZJHRPJH-NRFANRHFSA-N |
| XLogP | 3.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|