C19H22N2O5 — CID 4920001
4-amino-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-4-oxobutanoic acid (PubChem CID 4920001) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-amino-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4920001 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-amino-2-[[4-[2-(1-hydroxycyclohexyl)ethynyl]benzoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)c1ccc(C#CC2(O)CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C19H22N2O5/c20-16(22)12-15(18(24)25)21-17(23)14-6-4-13(5-7-14)8-11-19(26)9-2-1-3-10-19/h4-7,15,26H,1-3,9-10,12H2,(H2,20,22)(H,21,23)(H,24,25) |
| InChIKey | HGTAJWJDASCCHY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|