C17H23N2NaO3 — CID 23672180
sodium (2S)-2-[[1-(methylcarbamoyl)cyclohexyl]amino]-3-phenylpropanoate (PubChem CID 23672180) has the molecular formula C17H23N2NaO3 and a molecular weight of 326.37 g/mol. Its IUPAC name is sodium (2S)-2-[[1-(methylcarbamoyl)cyclohexyl]amino]-3-phenylpropanoate.
| Compound Name | sodium (2S)-2-[[1-(methylcarbamoyl)cyclohexyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 23672180 |
| Molecular Formula | C17H23N2NaO3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | sodium (2S)-2-[[1-(methylcarbamoyl)cyclohexyl]amino]-3-phenylpropanoate |
| SMILES | CNC(=O)C1(N[C@@H](Cc2ccccc2)C(=O)[O-])CCCCC1.[Na+] |
| InChI | InChI=1S/C17H24N2O3.Na/c1-18-16(22)17(10-6-3-7-11-17)19-14(15(20)21)12-13-8-4-2-5-9-13;/h2,4-5,8-9,14,19H,3,6-7,10-12H2,1H3,(H,18,22)(H,20,21);/q;+1/p-1/t14-;/m0./s1 |
| InChIKey | YQHHBIVPEFMKIZ-UQKRIMTDSA-M |
| XLogP | -2.61 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |