C23H29N3O2 — CID 119061773
1-(2,2-diphenylethylcarbamoylamino)-N-methylcyclohexane-1-carboxamide (PubChem CID 119061773) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-(2,2-diphenylethylcarbamoylamino)-N-methylcyclohexane-1-carboxamide.
| Compound Name | 1-(2,2-diphenylethylcarbamoylamino)-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119061773 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-(2,2-diphenylethylcarbamoylamino)-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1(NC(=O)NCC(c2ccccc2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C23H29N3O2/c1-24-21(27)23(15-9-4-10-16-23)26-22(28)25-17-20(18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-3,5-8,11-14,20H,4,9-10,15-17H2,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | AZABKTBQPLNEBR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |