C18H27N3O2 — CID 3221292
N-butan-2-yl-1-(phenylcarbamoylamino)cyclohexane-1-carboxamide (PubChem CID 3221292) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-butan-2-yl-1-(phenylcarbamoylamino)cyclohexane-1-carboxamide.
| Compound Name | N-butan-2-yl-1-(phenylcarbamoylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3221292 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-butan-2-yl-1-(phenylcarbamoylamino)cyclohexane-1-carboxamide |
| SMILES | CCC(C)NC(=O)C1(NC(=O)Nc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H27N3O2/c1-3-14(2)19-16(22)18(12-8-5-9-13-18)21-17(23)20-15-10-6-4-7-11-15/h4,6-7,10-11,14H,3,5,8-9,12-13H2,1-2H3,(H,19,22)(H2,20,21,23) |
| InChIKey | PRBDKFKVKYELRD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |