C20H28N2O5 — CID 24740123
(2S)-3-methyl-2-[[1-(phenylmethoxycarbonylamino)cyclohexanecarbonyl]amino]butanoic acid (PubChem CID 24740123) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[1-(phenylmethoxycarbonylamino)cyclohexanecarbonyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[1-(phenylmethoxycarbonylamino)cyclohexanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24740123 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2S)-3-methyl-2-[[1-(phenylmethoxycarbonylamino)cyclohexanecarbonyl]amino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C1(NC(=O)OCc2ccccc2)CCCCC1)C(=O)O |
| InChI | InChI=1S/C20H28N2O5/c1-14(2)16(17(23)24)21-18(25)20(11-7-4-8-12-20)22-19(26)27-13-15-9-5-3-6-10-15/h3,5-6,9-10,14,16H,4,7-8,11-13H2,1-2H3,(H,21,25)(H,22,26)(H,23,24)/t16-/m0/s1 |
| InChIKey | ZOOPBSQKBCEKRD-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |