C21H32N2O4 — CID 143504553
2-phenylethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate (PubChem CID 143504553) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-phenylethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | 2-phenylethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 143504553 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-phenylethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)[C@@H](CO)NC(=O)C1(NC(=O)OCCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H32N2O4/c1-16(2)18(15-24)22-19(25)21(12-7-4-8-13-21)23-20(26)27-14-11-17-9-5-3-6-10-17/h3,5-6,9-10,16,18,24H,4,7-8,11-15H2,1-2H3,(H,22,25)(H,23,26)/t18-/m1/s1 |
| InChIKey | OQSXDVHDSKYPFO-GOSISDBHSA-N |
| XLogP | 2.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |