C21H32N2O4 — CID 74341660
benzyl N-[1-(1-hydroxyhexan-2-ylcarbamoyl)cyclohexyl]carbamate (PubChem CID 74341660) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is benzyl N-[1-(1-hydroxyhexan-2-ylcarbamoyl)cyclohexyl]carbamate.
| Compound Name | benzyl N-[1-(1-hydroxyhexan-2-ylcarbamoyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 74341660 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | benzyl N-[1-(1-hydroxyhexan-2-ylcarbamoyl)cyclohexyl]carbamate |
| SMILES | CCCCC(CO)NC(=O)C1(NC(=O)OCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H32N2O4/c1-2-3-12-18(15-24)22-19(25)21(13-8-5-9-14-21)23-20(26)27-16-17-10-6-4-7-11-17/h4,6-7,10-11,18,24H,2-3,5,8-9,12-16H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | JZKAVZKGBQTADK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |