C16H19NO5 — CID 134181852
ethyl 3-oxo-3-[1-(phenylmethoxycarbonylamino)cyclopropyl]propanoate (PubChem CID 134181852) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl 3-oxo-3-[1-(phenylmethoxycarbonylamino)cyclopropyl]propanoate.
| Compound Name | ethyl 3-oxo-3-[1-(phenylmethoxycarbonylamino)cyclopropyl]propanoate |
|---|---|
| PubChem CID | 134181852 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethyl 3-oxo-3-[1-(phenylmethoxycarbonylamino)cyclopropyl]propanoate |
| SMILES | CCOC(=O)CC(=O)C1(NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C16H19NO5/c1-2-21-14(19)10-13(18)16(8-9-16)17-15(20)22-11-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,17,20) |
| InChIKey | UNLBRQFDWCYXGQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|