C26H32N2O7 — CID 158945243
benzyl N-[1-(hydroxymethyl)cyclopropyl]carbamate;ethyl 1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylate (PubChem CID 158945243) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is benzyl N-[1-(hydroxymethyl)cyclopropyl]carbamate;ethyl 1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylate.
| Compound Name | benzyl N-[1-(hydroxymethyl)cyclopropyl]carbamate;ethyl 1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 158945243 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | benzyl N-[1-(hydroxymethyl)cyclopropyl]carbamate;ethyl 1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)OCc2ccccc2)CC1.O=C(NC1(CO)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO4.C12H15NO3/c1-2-18-12(16)14(8-9-14)15-13(17)19-10-11-6-4-3-5-7-11;14-9-12(6-7-12)13-11(15)16-8-10-4-2-1-3-5-10/h3-7H,2,8-10H2,1H3,(H,15,17);1-5,14H,6-9H2,(H,13,15) |
| InChIKey | JKSYFBSADZNUQX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|