C26H30N2O7 — CID 171936751
9-O-benzyl 7-O-ethyl 7-(phenylmethoxycarbonylamino)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate (PubChem CID 171936751) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is 9-O-benzyl 7-O-ethyl 7-(phenylmethoxycarbonylamino)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate.
| Compound Name | 9-O-benzyl 7-O-ethyl 7-(phenylmethoxycarbonylamino)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate |
|---|---|
| PubChem CID | 171936751 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 9-O-benzyl 7-O-ethyl 7-(phenylmethoxycarbonylamino)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate |
| SMILES | CCOC(=O)C1(NC(=O)OCc2ccccc2)CC2COCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H30N2O7/c1-2-33-23(29)26(27-24(30)34-15-19-9-5-3-6-10-19)13-21-17-32-18-22(14-26)28(21)25(31)35-16-20-11-7-4-8-12-20/h3-12,21-22H,2,13-18H2,1H3,(H,27,30) |
| InChIKey | DPYAWVZMJGAGEF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|