C20H28N2O4 — CID 74341663
benzyl N-[1-[(3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]carbamate (PubChem CID 74341663) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is benzyl N-[1-[(3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[1-[(3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 74341663 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | benzyl N-[1-[(3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)C(C=O)NC(=O)C1(NC(=O)OCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H28N2O4/c1-15(2)17(13-23)21-18(24)20(11-7-4-8-12-20)22-19(25)26-14-16-9-5-3-6-10-16/h3,5-6,9-10,13,15,17H,4,7-8,11-12,14H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | FOEXKNOADJXYDM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|