C14H19NO3 — CID 91116688
benzyl N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]-N-tritiocarbamate (PubChem CID 91116688) has the molecular formula C14H19NO3 and a molecular weight of 251.32 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]-N-tritiocarbamate.
| Compound Name | benzyl N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]-N-tritiocarbamate |
|---|---|
| PubChem CID | 91116688 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | benzyl N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]-N-tritiocarbamate |
| SMILES | [3H]N(C(=O)OCc1ccccc1)[C@H](C=O)[C@@H](C)CC |
| InChI | InChI=1S/C14H19NO3/c1-3-11(2)13(9-16)15-14(17)18-10-12-7-5-4-6-8-12/h4-9,11,13H,3,10H2,1-2H3,(H,15,17)/t11-,13+/m0/s1/i/hT |
| InChIKey | VJCXBFMFEZXGDB-PVUVMUEKSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|