C36H54N4O10 — CID 161101792
furan-2-ylmethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate;furan-2-ylmethyl N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]carbamate (PubChem CID 161101792) has the molecular formula C36H54N4O10 and a molecular weight of 702.85 g/mol. Its IUPAC name is furan-2-ylmethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate;furan-2-ylmethyl N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | furan-2-ylmethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate;furan-2-ylmethyl N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 161101792 |
| Molecular Formula | C36H54N4O10 |
| Molecular Weight | 702.85 g/mol |
| Exact Mass | 702.38 |
| IUPAC Name | furan-2-ylmethyl N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]carbamate;furan-2-ylmethyl N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)[C@@H](C=O)NC(=O)C1(NC(=O)OCc2ccco2)CCCCC1.CC(C)[C@@H](CO)NC(=O)C1(NC(=O)OCc2ccco2)CCCCC1 |
| InChI | InChI=1S/C18H28N2O5.C18H26N2O5/c2*1-13(2)15(11-21)19-16(22)18(8-4-3-5-9-18)20-17(23)25-12-14-7-6-10-24-14/h6-7,10,13,15,21H,3-5,8-9,11-12H2,1-2H3,(H,19,22)(H,20,23);6-7,10-11,13,15H,3-5,8-9,12H2,1-2H3,(H,19,22)(H,20,23)/t2*15-/m11/s1 |
| InChIKey | UINKVXMMYQGPQA-PZYGRECOSA-N |
| XLogP | 4.89 |
| TPSA | 198.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.85 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|