C34H50N4O8 — CID 160875585
N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide;N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide (PubChem CID 160875585) has the molecular formula C34H50N4O8 and a molecular weight of 642.79 g/mol. Its IUPAC name is N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide;N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide.
| Compound Name | N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide;N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 160875585 |
| Molecular Formula | C34H50N4O8 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | N-[1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide;N-[1-[[(2S)-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohexyl]furan-3-carboxamide |
| SMILES | CC(C)[C@@H](C=O)NC(=O)C1(NC(=O)c2ccoc2)CCCCC1.CC(C)[C@@H](CO)NC(=O)C1(NC(=O)c2ccoc2)CCCCC1 |
| InChI | InChI=1S/C17H26N2O4.C17H24N2O4/c2*1-12(2)14(10-20)18-16(22)17(7-4-3-5-8-17)19-15(21)13-6-9-23-11-13/h6,9,11-12,14,20H,3-5,7-8,10H2,1-2H3,(H,18,22)(H,19,21);6,9-12,14H,3-5,7-8H2,1-2H3,(H,18,22)(H,19,21)/t2*14-/m11/s1 |
| InChIKey | SMIQMFWAXQZITF-RPERETBRSA-N |
| XLogP | 3.90 |
| TPSA | 179.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|