C21H30N2O3 — CID 141121357
benzyl N-[4-(butan-2-ylcarbamoyl)-1-bicyclo[2.2.2]octanyl]carbamate (PubChem CID 141121357) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is benzyl N-[4-(butan-2-ylcarbamoyl)-1-bicyclo[2.2.2]octanyl]carbamate.
| Compound Name | benzyl N-[4-(butan-2-ylcarbamoyl)-1-bicyclo[2.2.2]octanyl]carbamate |
|---|---|
| PubChem CID | 141121357 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | benzyl N-[4-(butan-2-ylcarbamoyl)-1-bicyclo[2.2.2]octanyl]carbamate |
| SMILES | CCC(C)NC(=O)C12CCC(NC(=O)OCc3ccccc3)(CC1)CC2 |
| InChI | InChI=1S/C21H30N2O3/c1-3-16(2)22-18(24)20-9-12-21(13-10-20,14-11-20)23-19(25)26-15-17-7-5-4-6-8-17/h4-8,16H,3,9-15H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | DEIAYFAPCWOATP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |