C17H24ClN3O2 — CID 119070824
1-[1-(4-chlorophenyl)ethylcarbamoylamino]-N-methylcyclohexane-1-carboxamide (PubChem CID 119070824) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethylcarbamoylamino]-N-methylcyclohexane-1-carboxamide.
| Compound Name | 1-[1-(4-chlorophenyl)ethylcarbamoylamino]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119070824 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethylcarbamoylamino]-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1(NC(=O)NC(C)c2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-12(13-6-8-14(18)9-7-13)20-16(23)21-17(15(22)19-2)10-4-3-5-11-17/h6-9,12H,3-5,10-11H2,1-2H3,(H,19,22)(H2,20,21,23) |
| InChIKey | RPMOJFVJNGZCEY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |