C20H22O4 — CID 59927754
methyl 2-[(S)-hydroxy-(4-methoxyphenyl)methyl]-3-phenylpent-4-enoate (PubChem CID 59927754) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is methyl 2-[(S)-hydroxy-(4-methoxyphenyl)methyl]-3-phenylpent-4-enoate.
| Compound Name | methyl 2-[(S)-hydroxy-(4-methoxyphenyl)methyl]-3-phenylpent-4-enoate |
|---|---|
| PubChem CID | 59927754 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | methyl 2-[(S)-hydroxy-(4-methoxyphenyl)methyl]-3-phenylpent-4-enoate |
| SMILES | C=CC(c1ccccc1)C(C(=O)OC)[C@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22O4/c1-4-17(14-8-6-5-7-9-14)18(20(22)24-3)19(21)15-10-12-16(23-2)13-11-15/h4-13,17-19,21H,1H2,2-3H3/t17?,18?,19-/m1/s1 |
| InChIKey | GTJIILARAVDHAR-CTWPCTMYSA-N |
| XLogP | 3.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|