C19H23NO2 — CID 134834536
(1R,2S)-2-[(1R)-1-amino-1-(4-methoxyphenyl)ethyl]-1-phenylbut-3-en-1-ol (PubChem CID 134834536) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,2S)-2-[(1R)-1-amino-1-(4-methoxyphenyl)ethyl]-1-phenylbut-3-en-1-ol.
| Compound Name | (1R,2S)-2-[(1R)-1-amino-1-(4-methoxyphenyl)ethyl]-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 134834536 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1R,2S)-2-[(1R)-1-amino-1-(4-methoxyphenyl)ethyl]-1-phenylbut-3-en-1-ol |
| SMILES | C=C[C@H]([C@@H](O)c1ccccc1)[C@@](C)(N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-4-17(18(21)14-8-6-5-7-9-14)19(2,20)15-10-12-16(22-3)13-11-15/h4-13,17-18,21H,1,20H2,2-3H3/t17-,18+,19+/m1/s1 |
| InChIKey | BFCYPTNXKIQQIX-QYZOEREBSA-N |
| XLogP | 3.40 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|