C21H20O2S — CID 101428948
(1S,2S)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethanol (PubChem CID 101428948) has the molecular formula C21H20O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is (1S,2S)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethanol.
| Compound Name | (1S,2S)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethanol |
|---|---|
| PubChem CID | 101428948 |
| Molecular Formula | C21H20O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (1S,2S)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethanol |
| SMILES | COc1ccc(S[C@@H](c2ccccc2)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20O2S/c1-23-18-12-14-19(15-13-18)24-21(17-10-6-3-7-11-17)20(22)16-8-4-2-5-9-16/h2-15,20-22H,1H3/t20-,21-/m0/s1 |
| InChIKey | NPOXYHSIGMIARI-SFTDATJTSA-N |
| XLogP | 5.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |