C20H17ClOS — CID 146163389
2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanol (PubChem CID 146163389) has the molecular formula C20H17ClOS and a molecular weight of 340.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanol.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanol |
|---|---|
| PubChem CID | 146163389 |
| Molecular Formula | C20H17ClOS |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanol |
| SMILES | OC(c1ccccc1)C(Sc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H17ClOS/c21-17-11-13-18(14-12-17)23-20(16-9-5-2-6-10-16)19(22)15-7-3-1-4-8-15/h1-14,19-20,22H |
| InChIKey | OTEFYYRYGPIEEB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |