C20H15ClOS — CID 2797592
2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanone (PubChem CID 2797592) has the molecular formula C20H15ClOS and a molecular weight of 338.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanone.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanone |
|---|---|
| PubChem CID | 2797592 |
| Molecular Formula | C20H15ClOS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(Sc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H15ClOS/c21-17-11-13-18(14-12-17)23-20(16-9-5-2-6-10-16)19(22)15-7-3-1-4-8-15/h1-14,20H |
| InChIKey | CGODCJFDRZPZFJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |