C19H15NO2S — CID 8605349
(2S)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2-diphenylethanone (PubChem CID 8605349) has the molecular formula C19H15NO2S and a molecular weight of 321.40 g/mol. Its IUPAC name is (2S)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2-diphenylethanone.
| Compound Name | (2S)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2-diphenylethanone |
|---|---|
| PubChem CID | 8605349 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (2S)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)[C@@H](Sc1cccc[n+]1[O-])c1ccccc1 |
| InChI | InChI=1S/C19H15NO2S/c21-18(15-9-3-1-4-10-15)19(16-11-5-2-6-12-16)23-17-13-7-8-14-20(17)22/h1-14,19H/t19-/m0/s1 |
| InChIKey | OAWFHCHLHOLEMK-IBGZPJMESA-N |
| XLogP | 4.04 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|