C14H14N2O6S2 — CID 139068181
2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetic acid (PubChem CID 139068181) has the molecular formula C14H14N2O6S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetic acid.
| Compound Name | 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 139068181 |
| Molecular Formula | C14H14N2O6S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetic acid |
| SMILES | O=C(O)CSc1cccc[n+]1[O-].O=C(O)CSc1cccc[n+]1[O-] |
| InChI | InChI=1S/2C7H7NO3S/c2*9-7(10)5-12-6-3-1-2-4-8(6)11/h2*1-4H,5H2,(H,9,10) |
| InChIKey | DWFJINPATJWCKE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|