C9H9Cl3N2O2S — CID 13471203
N-[2,2,2-trichloro-1-(1-oxidopyridin-1-ium-2-yl)sulfanylethyl]acetamide (PubChem CID 13471203) has the molecular formula C9H9Cl3N2O2S and a molecular weight of 315.61 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(1-oxidopyridin-1-ium-2-yl)sulfanylethyl]acetamide.
| Compound Name | N-[2,2,2-trichloro-1-(1-oxidopyridin-1-ium-2-yl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 13471203 |
| Molecular Formula | C9H9Cl3N2O2S |
| Molecular Weight | 315.61 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | N-[2,2,2-trichloro-1-(1-oxidopyridin-1-ium-2-yl)sulfanylethyl]acetamide |
| SMILES | CC(=O)NC(Sc1cccc[n+]1[O-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H9Cl3N2O2S/c1-6(15)13-8(9(10,11)12)17-7-4-2-3-5-14(7)16/h2-5,8H,1H3,(H,13,15) |
| InChIKey | ORYXDSIWFITZTM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|