C16H16Cl2N2O2S — CID 7795626
(2R)-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide (PubChem CID 7795626) has the molecular formula C16H16Cl2N2O2S and a molecular weight of 371.29 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7795626 |
| Molecular Formula | C16H16Cl2N2O2S |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (2R)-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
| SMILES | C[C@H](NC(=O)[C@@H](C)Sc1cccc[n+]1[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O2S/c1-10(13-7-6-12(17)9-14(13)18)19-16(21)11(2)23-15-5-3-4-8-20(15)22/h3-11H,1-2H3,(H,19,21)/t10-,11+/m0/s1 |
| InChIKey | BJUXXMWNBKVURX-WDEREUQCSA-N |
| XLogP | 3.98 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|