C20H16Br2OS — CID 135006163
(1S,2S)-1,2-bis(4-bromophenyl)-2-phenylsulfanylethanol (PubChem CID 135006163) has the molecular formula C20H16Br2OS and a molecular weight of 464.22 g/mol. Its IUPAC name is (1S,2S)-1,2-bis(4-bromophenyl)-2-phenylsulfanylethanol.
| Compound Name | (1S,2S)-1,2-bis(4-bromophenyl)-2-phenylsulfanylethanol |
|---|---|
| PubChem CID | 135006163 |
| Molecular Formula | C20H16Br2OS |
| Molecular Weight | 464.22 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | (1S,2S)-1,2-bis(4-bromophenyl)-2-phenylsulfanylethanol |
| SMILES | O[C@@H](c1ccc(Br)cc1)[C@@H](Sc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16Br2OS/c21-16-10-6-14(7-11-16)19(23)20(15-8-12-17(22)13-9-15)24-18-4-2-1-3-5-18/h1-13,19-20,23H/t19-,20-/m0/s1 |
| InChIKey | NNZZJRTXEMAFGX-PMACEKPBSA-N |
| XLogP | 6.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.22 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |