C15H15ClOS — CID 101161126
(1R,2S)-1-(4-chlorophenyl)-2-phenylsulfanylpropan-1-ol (PubChem CID 101161126) has the molecular formula C15H15ClOS and a molecular weight of 278.80 g/mol. Its IUPAC name is (1R,2S)-1-(4-chlorophenyl)-2-phenylsulfanylpropan-1-ol.
| Compound Name | (1R,2S)-1-(4-chlorophenyl)-2-phenylsulfanylpropan-1-ol |
|---|---|
| PubChem CID | 101161126 |
| Molecular Formula | C15H15ClOS |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (1R,2S)-1-(4-chlorophenyl)-2-phenylsulfanylpropan-1-ol |
| SMILES | C[C@H](Sc1ccccc1)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClOS/c1-11(18-14-5-3-2-4-6-14)15(17)12-7-9-13(16)10-8-12/h2-11,15,17H,1H3/t11-,15-/m0/s1 |
| InChIKey | AKBCZVAIZRBNSP-NHYWBVRUSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |