C17H18OS — CID 14787941
(1R,2R)-1-phenyl-1-phenylsulfanylpent-4-en-2-ol (PubChem CID 14787941) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is (1R,2R)-1-phenyl-1-phenylsulfanylpent-4-en-2-ol.
| Compound Name | (1R,2R)-1-phenyl-1-phenylsulfanylpent-4-en-2-ol |
|---|---|
| PubChem CID | 14787941 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1R,2R)-1-phenyl-1-phenylsulfanylpent-4-en-2-ol |
| SMILES | C=CC[C@@H](O)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18OS/c1-2-9-16(18)17(14-10-5-3-6-11-14)19-15-12-7-4-8-13-15/h2-8,10-13,16-18H,1,9H2/t16-,17-/m1/s1 |
| InChIKey | FVTVOKOEBUCNQQ-IAGOWNOFSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|