C13H16S — CID 10632029
[(5E)-hepta-1,5-dien-4-yl]sulfanylbenzene (PubChem CID 10632029) has the molecular formula C13H16S and a molecular weight of 204.34 g/mol. Its IUPAC name is [(5E)-hepta-1,5-dien-4-yl]sulfanylbenzene.
| Compound Name | [(5E)-hepta-1,5-dien-4-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10632029 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | [(5E)-hepta-1,5-dien-4-yl]sulfanylbenzene |
| SMILES | C=CCC(/C=C/C)Sc1ccccc1 |
| InChI | InChI=1S/C13H16S/c1-3-8-12(9-4-2)14-13-10-6-5-7-11-13/h3-7,9-12H,1,8H2,2H3/b9-4+ |
| InChIKey | BSELEPOQTQTNMP-RUDMXATFSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|