C14H18OS — CID 135037338
(2R,3S)-2,3-dimethyl-2-(2-phenylsulfanylbut-3-enyl)oxirane (PubChem CID 135037338) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is (2R,3S)-2,3-dimethyl-2-(2-phenylsulfanylbut-3-enyl)oxirane.
| Compound Name | (2R,3S)-2,3-dimethyl-2-(2-phenylsulfanylbut-3-enyl)oxirane |
|---|---|
| PubChem CID | 135037338 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (2R,3S)-2,3-dimethyl-2-(2-phenylsulfanylbut-3-enyl)oxirane |
| SMILES | C=CC(C[C@@]1(C)O[C@H]1C)Sc1ccccc1 |
| InChI | InChI=1S/C14H18OS/c1-4-12(10-14(3)11(2)15-14)16-13-8-6-5-7-9-13/h4-9,11-12H,1,10H2,2-3H3/t11-,12?,14+/m0/s1 |
| InChIKey | KHIMPRPINXKMMW-HFUMIRBISA-N |
| XLogP | 3.90 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|