C13H17NS — CID 15414578
N-methyl-4-phenylsulfanylhexa-1,5-dien-3-amine (PubChem CID 15414578) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is N-methyl-4-phenylsulfanylhexa-1,5-dien-3-amine.
| Compound Name | N-methyl-4-phenylsulfanylhexa-1,5-dien-3-amine |
|---|---|
| PubChem CID | 15414578 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-methyl-4-phenylsulfanylhexa-1,5-dien-3-amine |
| SMILES | C=CC(NC)C(C=C)Sc1ccccc1 |
| InChI | InChI=1S/C13H17NS/c1-4-12(14-3)13(5-2)15-11-9-7-6-8-10-11/h4-10,12-14H,1-2H2,3H3 |
| InChIKey | MAENNQISKBSYLU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|