C15H23N2PS — CID 130378822
2-N-methyl-1-[(E)-1-methylphosphanyl-3-phenylprop-1-en-2-yl]sulfanylbut-3-ene-1,2-diamine (PubChem CID 130378822) has the molecular formula C15H23N2PS and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-N-methyl-1-[(E)-1-methylphosphanyl-3-phenylprop-1-en-2-yl]sulfanylbut-3-ene-1,2-diamine.
| Compound Name | 2-N-methyl-1-[(E)-1-methylphosphanyl-3-phenylprop-1-en-2-yl]sulfanylbut-3-ene-1,2-diamine |
|---|---|
| PubChem CID | 130378822 |
| Molecular Formula | C15H23N2PS |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-N-methyl-1-[(E)-1-methylphosphanyl-3-phenylprop-1-en-2-yl]sulfanylbut-3-ene-1,2-diamine |
| SMILES | C=CC(NC)C(N)S/C(=C/PC)Cc1ccccc1 |
| InChI | InChI=1S/C15H23N2PS/c1-4-14(17-2)15(16)19-13(11-18-3)10-12-8-6-5-7-9-12/h4-9,11,14-15,17-18H,1,10,16H2,2-3H3/b13-11+ |
| InChIKey | WREHZFBTOIXACV-ACCUITESSA-N |
| XLogP | 3.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|