C18H21N — CID 10911987
(3R,4R)-N-benzyl-4-phenylpent-1-en-3-amine (PubChem CID 10911987) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (3R,4R)-N-benzyl-4-phenylpent-1-en-3-amine.
| Compound Name | (3R,4R)-N-benzyl-4-phenylpent-1-en-3-amine |
|---|---|
| PubChem CID | 10911987 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (3R,4R)-N-benzyl-4-phenylpent-1-en-3-amine |
| SMILES | C=C[C@@H](NCc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-3-18(15(2)17-12-8-5-9-13-17)19-14-16-10-6-4-7-11-16/h3-13,15,18-19H,1,14H2,2H3/t15-,18-/m1/s1 |
| InChIKey | XDMVRRFDUYVEOR-CRAIPNDOSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|