C13H17N — CID 11513891
(4E)-N-benzylhexa-1,4-dien-3-amine (PubChem CID 11513891) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (4E)-N-benzylhexa-1,4-dien-3-amine.
| Compound Name | (4E)-N-benzylhexa-1,4-dien-3-amine |
|---|---|
| PubChem CID | 11513891 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (4E)-N-benzylhexa-1,4-dien-3-amine |
| SMILES | C=CC(/C=C/C)NCc1ccccc1 |
| InChI | InChI=1S/C13H17N/c1-3-8-13(4-2)14-11-12-9-6-5-7-10-12/h3-10,13-14H,2,11H2,1H3/b8-3+ |
| InChIKey | MUYVAFUBEASKDK-FPYGCLRLSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|