C20H23N — CID 10707695
(2S,3Z,5E)-N-benzyl-1-phenylhepta-3,5-dien-2-amine (PubChem CID 10707695) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (2S,3Z,5E)-N-benzyl-1-phenylhepta-3,5-dien-2-amine.
| Compound Name | (2S,3Z,5E)-N-benzyl-1-phenylhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 10707695 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2S,3Z,5E)-N-benzyl-1-phenylhepta-3,5-dien-2-amine |
| SMILES | C/C=C/C=C\[C@H](Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-2-3-6-15-20(16-18-11-7-4-8-12-18)21-17-19-13-9-5-10-14-19/h2-15,20-21H,16-17H2,1H3/b3-2+,15-6-/t20-/m1/s1 |
| InChIKey | JIJXENNDRKHQMS-XEDSUSCESA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|