C19H21N — CID 10491814
(2S,3Z)-N-benzyl-1-phenylhexa-3,5-dien-2-amine (PubChem CID 10491814) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is (2S,3Z)-N-benzyl-1-phenylhexa-3,5-dien-2-amine.
| Compound Name | (2S,3Z)-N-benzyl-1-phenylhexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 10491814 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (2S,3Z)-N-benzyl-1-phenylhexa-3,5-dien-2-amine |
| SMILES | C=C/C=C\[C@H](Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C19H21N/c1-2-3-14-19(15-17-10-6-4-7-11-17)20-16-18-12-8-5-9-13-18/h2-14,19-20H,1,15-16H2/b14-3-/t19-/m1/s1 |
| InChIKey | IJIVRWYDQBUOQN-SVCIFPNUSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|