C22H20P+ — CID 2752732
buta-1,3-dienyl(triphenyl)phosphanium (PubChem CID 2752732) has the molecular formula C22H20P+ and a molecular weight of 315.38 g/mol. Its IUPAC name is buta-1,3-dienyl(triphenyl)phosphanium.
| Compound Name | buta-1,3-dienyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 2752732 |
| Molecular Formula | C22H20P+ |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | buta-1,3-dienyl(triphenyl)phosphanium |
| SMILES | C=CC=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20P/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h2-19H,1H2/q+1 |
| InChIKey | CQRVOJKIRCURAT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|