C12H12O2 — CID 100973348
(2S,3E)-2-hydroxy-1-phenylhexa-3,5-dien-1-one (PubChem CID 100973348) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2S,3E)-2-hydroxy-1-phenylhexa-3,5-dien-1-one.
| Compound Name | (2S,3E)-2-hydroxy-1-phenylhexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 100973348 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (2S,3E)-2-hydroxy-1-phenylhexa-3,5-dien-1-one |
| SMILES | C=C/C=C/[C@H](O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-2-3-9-11(13)12(14)10-7-5-4-6-8-10/h2-9,11,13H,1H2/b9-3+/t11-/m0/s1 |
| InChIKey | YOJDVAHGPKOKGW-BWLWAFFFSA-N |
| XLogP | 1.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|