C12H14O — CID 129364114
(E,2S)-2-methyl-1-phenylpent-3-en-1-one (PubChem CID 129364114) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (E,2S)-2-methyl-1-phenylpent-3-en-1-one.
| Compound Name | (E,2S)-2-methyl-1-phenylpent-3-en-1-one |
|---|---|
| PubChem CID | 129364114 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (E,2S)-2-methyl-1-phenylpent-3-en-1-one |
| SMILES | C/C=C/[C@H](C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-3-7-10(2)12(13)11-8-5-4-6-9-11/h3-10H,1-2H3/b7-3+/t10-/m0/s1 |
| InChIKey | WYBHTRNEZTWMEH-HTZNOQTFSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|