2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid

C32H32O4 — CID 87421077

IUPAC2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid
SMILESC=CC=CC(C=Cc1ccccc1)C(=C)C(=O)O.C=CC=CC(C=Cc1ccccc1)C(=C)C(=O)O
InChIInChI=1S/2C16H16O2/c2*1-3-4-10-15(13(2)16(17)18)12-11-14-8-6-5-7-9-14/h2*3-12,15H,1-2H2,(H,17,18)
InChIKeyFQGWNTLYVUXZMU-UHFFFAOYSA-N
MW480.60 g/mol
LogP7.40
Rot. Bonds12

About 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid

2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid (PubChem CID 87421077) has the molecular formula C32H32O4 and a molecular weight of 480.60 g/mol. Its IUPAC name is 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid.

Molecular Properties

Compound Name2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid
PubChem CID87421077
Molecular FormulaC32H32O4
Molecular Weight480.60 g/mol
Exact Mass480.23
IUPAC Name2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid
SMILESC=CC=CC(C=Cc1ccccc1)C(=C)C(=O)O.C=CC=CC(C=Cc1ccccc1)C(=C)C(=O)O
InChIInChI=1S/2C16H16O2/c2*1-3-4-10-15(13(2)16(17)18)12-11-14-8-6-5-7-9-14/h2*3-12,15H,1-2H2,(H,17,18)
InChIKeyFQGWNTLYVUXZMU-UHFFFAOYSA-N
XLogP7.40
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms36
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500480.60
LogP ≤ 57.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid?
The IUPAC name of 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid (CID 87421077) is 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid.
What is the SMILES notation for 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid?
The canonical SMILES for 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid is C=CC=CC(C=Cc1ccccc1)C(=C)C(=O)O.C=CC=CC(C=Cc1ccccc1)C(=C)C(=O)O.
What is the InChIKey of 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid?
The InChIKey is FQGWNTLYVUXZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H16O2/c2*1-3-4-10-15(13(2)16(17)18)12-11-14-8-6-5-7-9-14/h2*3-12,15H,1-2H2,(H,17,18).
What are the key properties of 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid?
2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid has a molecular weight of 480.60 g/mol, XLogP of 7.40, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3-(2-phenylethenyl)hepta-4,6-dienoic acid is sourced from PubChem (CID 87421077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).