C17H20O — CID 88694915
(1E,6E)-4-ethenyl-1-phenylnona-1,6,8-trien-3-ol (PubChem CID 88694915) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (1E,6E)-4-ethenyl-1-phenylnona-1,6,8-trien-3-ol.
| Compound Name | (1E,6E)-4-ethenyl-1-phenylnona-1,6,8-trien-3-ol |
|---|---|
| PubChem CID | 88694915 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (1E,6E)-4-ethenyl-1-phenylnona-1,6,8-trien-3-ol |
| SMILES | C=C/C=C/CC(C=C)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-3-5-7-12-16(4-2)17(18)14-13-15-10-8-6-9-11-15/h3-11,13-14,16-18H,1-2,12H2/b7-5+,14-13+ |
| InChIKey | QPJSDPGRCPNMQK-JSTHUUKUSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|