C28H29NOSe — CID 11145187
(E,2S,3R)-N,N-dibenzyl-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-eneselenoamide (PubChem CID 11145187) has the molecular formula C28H29NOSe and a molecular weight of 474.51 g/mol. Its IUPAC name is (E,2S,3R)-N,N-dibenzyl-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-eneselenoamide.
| Compound Name | (E,2S,3R)-N,N-dibenzyl-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-eneselenoamide |
|---|---|
| PubChem CID | 11145187 |
| Molecular Formula | C28H29NOSe |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (E,2S,3R)-N,N-dibenzyl-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-eneselenoamide |
| SMILES | C=CC[C@H](C(=[Se])N(Cc1ccccc1)Cc1ccccc1)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C28H29NOSe/c1-2-12-26(27(30)20-19-23-13-6-3-7-14-23)28(31)29(21-24-15-8-4-9-16-24)22-25-17-10-5-11-18-25/h2-11,13-20,26-27,30H,1,12,21-22H2/b20-19+/t26-,27+/m0/s1 |
| InChIKey | YRAYSEIFGNLKEL-LPTRFYTHSA-N |
| XLogP | 5.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|