C27H29NO — CID 100951400
(2S)-2-[benzyl-[(1E)-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol (PubChem CID 100951400) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is (2S)-2-[benzyl-[(1E)-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol.
| Compound Name | (2S)-2-[benzyl-[(1E)-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 100951400 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (2S)-2-[benzyl-[(1E)-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol |
| SMILES | C=CCC(/C=C/c1ccccc1)N(Cc1ccccc1)[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C27H29NO/c1-2-12-26(20-19-23-13-6-3-7-14-23)28(21-24-15-8-4-9-16-24)27(22-29)25-17-10-5-11-18-25/h2-11,13-20,26-27,29H,1,12,21-22H2/b20-19+/t26?,27-/m1/s1 |
| InChIKey | HJNCXNZACFXFSU-AAYYUGBJSA-N |
| XLogP | 5.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|