C30H29NO — CID 91271714
2-[(1R)-1-[benzyl-[(1S)-1-phenylethyl]amino]-3-phenylprop-2-enyl]phenol (PubChem CID 91271714) has the molecular formula C30H29NO and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[(1R)-1-[benzyl-[(1S)-1-phenylethyl]amino]-3-phenylprop-2-enyl]phenol.
| Compound Name | 2-[(1R)-1-[benzyl-[(1S)-1-phenylethyl]amino]-3-phenylprop-2-enyl]phenol |
|---|---|
| PubChem CID | 91271714 |
| Molecular Formula | C30H29NO |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[(1R)-1-[benzyl-[(1S)-1-phenylethyl]amino]-3-phenylprop-2-enyl]phenol |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@H](C=Cc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C30H29NO/c1-24(27-17-9-4-10-18-27)31(23-26-15-7-3-8-16-26)29(28-19-11-12-20-30(28)32)22-21-25-13-5-2-6-14-25/h2-22,24,29,32H,23H2,1H3/t24-,29+/m0/s1 |
| InChIKey | GQQGKQNZVLTEQU-PWUYWRBVSA-N |
| XLogP | 7.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|